About 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane
3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane (PubChem CID 176943216) has the molecular formula C10H20F4N2S
and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane.
Molecular Properties
| Compound Name | 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane |
| PubChem CID | 176943216 |
| Molecular Formula | C10H20F4N2S |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane |
| SMILES | CC1CNC(SC(F)(F)F)C(F)C1N.CCC |
| InChI | InChI=1S/C7H12F4N2S.C3H8/c1-3-2-13-6(4(8)5(3)12)14-7(9,10)11;1-3-2/h3-6,13H,2,12H2,1H3;3H2,1-2H3 |
| InChIKey | OKTIKNPEDGCBHC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane?
The IUPAC name of 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane (CID 176943216) is 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane.
What is the SMILES notation for 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane?
The canonical SMILES for 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane is CC1CNC(SC(F)(F)F)C(F)C1N.CCC.
What is the InChIKey of 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane?
The InChIKey is OKTIKNPEDGCBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F4N2S.C3H8/c1-3-2-13-6(4(8)5(3)12)14-7(9,10)11;1-3-2/h3-6,13H,2,12H2,1H3;3H2,1-2H3.
What are the key properties of 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane?
3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane has a molecular weight of 276.34 g/mol, XLogP of 2.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-methyl-2-(trifluoromethylsulfanyl)piperidin-4-amine;propane is sourced from PubChem (CID 176943216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).