About N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide
N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide (PubChem CID 176943754) has the molecular formula C11H31N3
and a molecular weight of 205.39 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide |
| PubChem CID | 176943754 |
| Molecular Formula | C11H31N3 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.25 |
| IUPAC Name | N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide |
| SMILES | C/N=C/N(C)C.CC.CC.CN(C)C |
| InChI | InChI=1S/C4H10N2.C3H9N.2C2H6/c1-5-4-6(2)3;1-4(2)3;2*1-2/h4H,1-3H3;1-3H3;2*1-2H3/b5-4+;;; |
| InChIKey | HDNINRISGIKTTB-WVFFXBQBSA-N |
| XLogP | 2.44 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide?
The IUPAC name of N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide (CID 176943754) is N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide.
What is the SMILES notation for N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide?
The canonical SMILES for N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide is C/N=C/N(C)C.CC.CC.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide?
The InChIKey is HDNINRISGIKTTB-WVFFXBQBSA-N. The full InChI is InChI=1S/C4H10N2.C3H9N.2C2H6/c1-5-4-6(2)3;1-4(2)3;2*1-2/h4H,1-3H3;1-3H3;2*1-2H3/b5-4+;;;.
What are the key properties of N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide?
N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide has a molecular weight of 205.39 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide is sourced from PubChem (CID 176943754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).