C11H31N3 — CID 176943754
N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide (PubChem CID 176943754) has the molecular formula C11H31N3 and a molecular weight of 205.39 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide.
| Compound Name | N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide |
|---|---|
| PubChem CID | 176943754 |
| Molecular Formula | C11H31N3 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.25 |
| IUPAC Name | N,N-dimethylmethanamine;ethane;N,N,N'-trimethylmethanimidamide |
| SMILES | C/N=C/N(C)C.CC.CC.CN(C)C |
| InChI | InChI=1S/C4H10N2.C3H9N.2C2H6/c1-5-4-6(2)3;1-4(2)3;2*1-2/h4H,1-3H3;1-3H3;2*1-2H3/b5-4+;;; |
| InChIKey | HDNINRISGIKTTB-WVFFXBQBSA-N |
| XLogP | 2.44 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|