About ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine
ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine (PubChem CID 176943859) has the molecular formula C12H27N
and a molecular weight of 185.35 g/mol. Its IUPAC name is ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine.
Molecular Properties
| Compound Name | ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine |
| PubChem CID | 176943859 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine |
| SMILES | C/C=C\N=C(C)C.C=C.CC.CC |
| InChI | InChI=1S/C6H11N.2C2H6.C2H4/c1-4-5-7-6(2)3;3*1-2/h4-5H,1-3H3;2*1-2H3;1-2H2/b5-4-;;; |
| InChIKey | MNTAMSSKPUENFE-OAWHIZORSA-N |
| XLogP | 4.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine?
The IUPAC name of ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine (CID 176943859) is ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine.
What is the SMILES notation for ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine?
The canonical SMILES for ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine is C/C=C\N=C(C)C.C=C.CC.CC.
What is the InChIKey of ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine?
The InChIKey is MNTAMSSKPUENFE-OAWHIZORSA-N. The full InChI is InChI=1S/C6H11N.2C2H6.C2H4/c1-4-5-7-6(2)3;3*1-2/h4-5H,1-3H3;2*1-2H3;1-2H2/b5-4-;;;.
What are the key properties of ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine?
ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine has a molecular weight of 185.35 g/mol, XLogP of 4.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;N-[(Z)-prop-1-enyl]propan-2-imine is sourced from PubChem (CID 176943859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).