C16H17ClN2 — CID 176943908
2-benzyl-5-chloro-7-methyl-1,3-dihydroisoindol-4-amine (PubChem CID 176943908) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-benzyl-5-chloro-7-methyl-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-benzyl-5-chloro-7-methyl-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 176943908 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-benzyl-5-chloro-7-methyl-1,3-dihydroisoindol-4-amine |
| SMILES | Cc1cc(Cl)c(N)c2c1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C16H17ClN2/c1-11-7-15(17)16(18)14-10-19(9-13(11)14)8-12-5-3-2-4-6-12/h2-7H,8-10,18H2,1H3 |
| InChIKey | BWXXGKCQTQZILF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|