C30H24ClF3N10O4 — CID 176945114
2-[[5-[[4-[[4-(aminomethyl)-6-chloro-2-methylindazol-5-yl]amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]methyl]-1,2,4-triazol-1-yl]methyl]benzoic acid (PubChem CID 176945114) has the molecular formula C30H24ClF3N10O4 and a molecular weight of 681.04 g/mol. Its IUPAC name is 2-[[5-[[4-[[4-(aminomethyl)-6-chloro-2-methylindazol-5-yl]amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]methyl]-1,2,4-triazol-1-yl]methyl]benzoic acid.
| Compound Name | 2-[[5-[[4-[[4-(aminomethyl)-6-chloro-2-methylindazol-5-yl]amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]methyl]-1,2,4-triazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 176945114 |
| Molecular Formula | C30H24ClF3N10O4 |
| Molecular Weight | 681.04 g/mol |
| Exact Mass | 680.16 |
| IUPAC Name | 2-[[5-[[4-[[4-(aminomethyl)-6-chloro-2-methylindazol-5-yl]amino]-2,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazin-1-yl]methyl]-1,2,4-triazol-1-yl]methyl]benzoic acid |
| SMILES | Cn1cc2c(CN)c(Nc3nc(=O)n(Cc4ncnn4Cc4ccccc4C(=O)O)c(=O)n3Cc3cc(F)c(F)cc3F)c(Cl)cc2n1 |
| InChI | InChI=1S/C30H24ClF3N10O4/c1-41-12-19-18(9-35)26(20(31)7-24(19)40-41)38-28-39-29(47)43(30(48)42(28)10-16-6-22(33)23(34)8-21(16)32)13-25-36-14-37-44(25)11-15-4-2-3-5-17(15)27(45)46/h2-8,12,14H,9-11,13,35H2,1H3,(H,45,46)(H,38,39,47) |
| InChIKey | RENDLTOCNPXRIU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 180.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.04 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|