C11H13ClF4N2OS — CID 176945435
(R)-N-[(1S)-1-(6-chloro-5-fluoro-3-pyridinyl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide (PubChem CID 176945435) has the molecular formula C11H13ClF4N2OS and a molecular weight of 332.75 g/mol. Its IUPAC name is (R)-N-[(1S)-1-(6-chloro-5-fluoro-3-pyridinyl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1-(6-chloro-5-fluoro-3-pyridinyl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 176945435 |
| Molecular Formula | C11H13ClF4N2OS |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (R)-N-[(1S)-1-(6-chloro-5-fluoro-3-pyridinyl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](c1cnc(Cl)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C11H13ClF4N2OS/c1-10(2,3)20(19)18-8(11(14,15)16)6-4-7(13)9(12)17-5-6/h4-5,8,18H,1-3H3/t8-,20+/m0/s1 |
| InChIKey | NSZDTALJZUUXJK-FFVOIRBGSA-N |
| XLogP | 3.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|