C11H23NO — CID 176945863
ethane;7-methyl-1,2,3,4,4a,5,6,7a-octahydrocyclopenta[c]pyridin-7-ol (PubChem CID 176945863) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is ethane;7-methyl-1,2,3,4,4a,5,6,7a-octahydrocyclopenta[c]pyridin-7-ol.
| Compound Name | ethane;7-methyl-1,2,3,4,4a,5,6,7a-octahydrocyclopenta[c]pyridin-7-ol |
|---|---|
| PubChem CID | 176945863 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | ethane;7-methyl-1,2,3,4,4a,5,6,7a-octahydrocyclopenta[c]pyridin-7-ol |
| SMILES | CC.CC1(O)CCC2CCNCC21 |
| InChI | InChI=1S/C9H17NO.C2H6/c1-9(11)4-2-7-3-5-10-6-8(7)9;1-2/h7-8,10-11H,2-6H2,1H3;1-2H3 |
| InChIKey | WVFAYUYQXJJGGE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |