C12H23FN2O — CID 176945966
(3R,4S,5R)-3-fluoro-N,5-dimethyl-1-(oxan-4-yl)piperidin-4-amine (PubChem CID 176945966) has the molecular formula C12H23FN2O and a molecular weight of 230.33 g/mol. Its IUPAC name is (3R,4S,5R)-3-fluoro-N,5-dimethyl-1-(oxan-4-yl)piperidin-4-amine.
| Compound Name | (3R,4S,5R)-3-fluoro-N,5-dimethyl-1-(oxan-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 176945966 |
| Molecular Formula | C12H23FN2O |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (3R,4S,5R)-3-fluoro-N,5-dimethyl-1-(oxan-4-yl)piperidin-4-amine |
| SMILES | CN[C@H]1[C@H](C)CN(C2CCOCC2)C[C@H]1F |
| InChI | InChI=1S/C12H23FN2O/c1-9-7-15(8-11(13)12(9)14-2)10-3-5-16-6-4-10/h9-12,14H,3-8H2,1-2H3/t9-,11-,12+/m1/s1 |
| InChIKey | HACGVVDRLFWWNJ-JLLWLGSASA-N |
| XLogP | 1.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |