C29H33F4N5O5S2 — CID 176946114
N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)-4-sulfanylpiperidin-4-yl]-6-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxamide (PubChem CID 176946114) has the molecular formula C29H33F4N5O5S2 and a molecular weight of 671.74 g/mol. Its IUPAC name is N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)-4-sulfanylpiperidin-4-yl]-6-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxamide.
| Compound Name | N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)-4-sulfanylpiperidin-4-yl]-6-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 176946114 |
| Molecular Formula | C29H33F4N5O5S2 |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.19 |
| IUPAC Name | N-[(3S,4S)-3-fluoro-1-(2-methoxyethyl)-4-sulfanylpiperidin-4-yl]-6-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxamide |
| SMILES | COCCN1CC[C@@](S)(NC(=O)c2cc(C#CCNc3ccc(S(C)(=O)=O)cc3OC)cc3c2ncn3CC(F)(F)F)[C@@H](F)C1 |
| InChI | InChI=1S/C29H33F4N5O5S2/c1-42-12-11-37-10-8-28(44,25(30)16-37)36-27(39)21-13-19(14-23-26(21)35-18-38(23)17-29(31,32)33)5-4-9-34-22-7-6-20(45(3,40)41)15-24(22)43-2/h6-7,13-15,18,25,34,44H,8-12,16-17H2,1-3H3,(H,36,39)/t25-,28-/m0/s1 |
| InChIKey | DZZVNKYJDRDQOY-LSYYVWMOSA-N |
| XLogP | 3.52 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|