About CID 176946533
CID 176946533 (PubChem CID 176946533) has the molecular formula C38H45IN11O2S-
and a molecular weight of 846.82 g/mol.
Molecular Properties
| Compound Name | CID 176946533 |
| PubChem CID | 176946533 |
| Molecular Formula | C38H45IN11O2S- |
| Molecular Weight | 846.82 g/mol |
| Exact Mass | 846.25 |
| IUPAC Name | — |
| SMILES | C[C@H]1CN(CC2CC2)CCCN1c1nc(-c2onc3c2CC[I-][C@@]32CCCc3sc(N)c(C#N)c32)cc(N2CCC3(CCN3C(=O)n3ccnc3)C2)n1 |
| InChI | InChI=1S/C38H45IN11O2S/c1-24-20-46(21-25-5-6-25)13-3-14-49(24)35-43-28(18-30(44-35)47-15-9-37(22-47)10-16-50(37)36(51)48-17-12-42-23-48)32-26-7-11-39-38(33(26)45-52-32)8-2-4-29-31(38)27(19-40)34(41)53-29/h12,17-18,23-25H,2-11,13-16,20-22,41H2,1H3/q-1/t24-,37?,38+/m0/s1 |
| InChIKey | NAQAHXLHICUZAJ-DWIFQPESSA-N |
| XLogP | 1.70 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 846.82 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 176946533 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176946533?
The IUPAC name of CID 176946533 (CID 176946533) is not available.
What is the SMILES notation for CID 176946533?
The canonical SMILES for CID 176946533 is C[C@H]1CN(CC2CC2)CCCN1c1nc(-c2onc3c2CC[I-][C@@]32CCCc3sc(N)c(C#N)c32)cc(N2CCC3(CCN3C(=O)n3ccnc3)C2)n1.
What is the InChIKey of CID 176946533?
The InChIKey is NAQAHXLHICUZAJ-DWIFQPESSA-N. The full InChI is InChI=1S/C38H45IN11O2S/c1-24-20-46(21-25-5-6-25)13-3-14-49(24)35-43-28(18-30(44-35)47-15-9-37(22-47)10-16-50(37)36(51)48-17-12-42-23-48)32-26-7-11-39-38(33(26)45-52-32)8-2-4-29-31(38)27(19-40)34(41)53-29/h12,17-18,23-25H,2-11,13-16,20-22,41H2,1H3/q-1/t24-,37?,38+/m0/s1.
What are the key properties of CID 176946533?
CID 176946533 has a molecular weight of 846.82 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176946533 is sourced from PubChem (CID 176946533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).