About N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine
N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine (PubChem CID 176947266) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine.
Analyze N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine?
The IUPAC name of N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine (CID 176947266) is N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine.
What is the SMILES notation for N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine?
The canonical SMILES for N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine is CC1=CC2CC2(N(C)C)C=C1.
What is the InChIKey of N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine?
The InChIKey is GZKGJKPYYBJWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-8-4-5-10(11(2)3)7-9(10)6-8/h4-6,9H,7H2,1-3H3.
What are the key properties of N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine?
N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine has a molecular weight of 149.24 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,4-trimethylbicyclo[4.1.0]hepta-2,4-dien-1-amine is sourced from PubChem (CID 176947266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).