About cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone
cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone (PubChem CID 176947510) has the molecular formula C13H16ClCsFNO
and a molecular weight of 389.63 g/mol. Its IUPAC name is cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone.
Molecular Properties
| Compound Name | cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone |
| PubChem CID | 176947510 |
| Molecular Formula | C13H16ClCsFNO |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone |
| SMILES | O=C(CC1CCCN1)c1cc(F)cc(Cl)c1.[CH3-].[Cs+] |
| InChI | InChI=1S/C12H13ClFNO.CH3.Cs/c13-9-4-8(5-10(14)6-9)12(16)7-11-2-1-3-15-11;;/h4-6,11,15H,1-3,7H2;1H3;/q;-1;+1 |
| InChIKey | OURCBEHCPXQXKE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone?
The IUPAC name of cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone (CID 176947510) is cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone.
What is the SMILES notation for cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone?
The canonical SMILES for cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone is O=C(CC1CCCN1)c1cc(F)cc(Cl)c1.[CH3-].[Cs+].
What is the InChIKey of cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone?
The InChIKey is OURCBEHCPXQXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClFNO.CH3.Cs/c13-9-4-8(5-10(14)6-9)12(16)7-11-2-1-3-15-11;;/h4-6,11,15H,1-3,7H2;1H3;/q;-1;+1.
What are the key properties of cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone?
cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone has a molecular weight of 389.63 g/mol, XLogP of 0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;carbanide;1-(3-chloro-5-fluorophenyl)-2-pyrrolidin-2-ylethanone is sourced from PubChem (CID 176947510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).