C20H29F3N2O2 — CID 176947516
(4Z)-4-[(Z)-but-2-en-2-yl]-N-methyl-3-(2-oxo-2-piperidin-1-ylethyl)-6-(trifluoromethyl)hepta-4,6-dienamide (PubChem CID 176947516) has the molecular formula C20H29F3N2O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is (4Z)-4-[(Z)-but-2-en-2-yl]-N-methyl-3-(2-oxo-2-piperidin-1-ylethyl)-6-(trifluoromethyl)hepta-4,6-dienamide.
| Compound Name | (4Z)-4-[(Z)-but-2-en-2-yl]-N-methyl-3-(2-oxo-2-piperidin-1-ylethyl)-6-(trifluoromethyl)hepta-4,6-dienamide |
|---|---|
| PubChem CID | 176947516 |
| Molecular Formula | C20H29F3N2O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (4Z)-4-[(Z)-but-2-en-2-yl]-N-methyl-3-(2-oxo-2-piperidin-1-ylethyl)-6-(trifluoromethyl)hepta-4,6-dienamide |
| SMILES | C=C(/C=C(C(\C)=C/C)/C(CC(=O)NC)CC(=O)N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C20H29F3N2O2/c1-5-14(2)17(11-15(3)20(21,22)23)16(12-18(26)24-4)13-19(27)25-9-7-6-8-10-25/h5,11,16H,3,6-10,12-13H2,1-2,4H3,(H,24,26)/b14-5-,17-11+ |
| InChIKey | CGDOQFQLWVCWMX-OIGZCBAWSA-N |
| XLogP | 4.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|