C19H25F3O3 — CID 176947557
ethyl 2-[3-methyl-2-[4-methyl-4-(trifluoromethoxy)cyclohexyl]phenyl]acetate (PubChem CID 176947557) has the molecular formula C19H25F3O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is ethyl 2-[3-methyl-2-[4-methyl-4-(trifluoromethoxy)cyclohexyl]phenyl]acetate.
| Compound Name | ethyl 2-[3-methyl-2-[4-methyl-4-(trifluoromethoxy)cyclohexyl]phenyl]acetate |
|---|---|
| PubChem CID | 176947557 |
| Molecular Formula | C19H25F3O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | ethyl 2-[3-methyl-2-[4-methyl-4-(trifluoromethoxy)cyclohexyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(C)c1C1CCC(C)(OC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H25F3O3/c1-4-24-16(23)12-15-7-5-6-13(2)17(15)14-8-10-18(3,11-9-14)25-19(20,21)22/h5-7,14H,4,8-12H2,1-3H3 |
| InChIKey | CNYBUYYFIKWIBE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |