C33H32ClN9O3 — CID 176947843
3-[6-[(2S,6R)-4-[5-chloro-4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]pyrimidin-2-yl]-2-ethynyl-6-methylpiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione (PubChem CID 176947843) has the molecular formula C33H32ClN9O3 and a molecular weight of 638.13 g/mol. Its IUPAC name is 3-[6-[(2S,6R)-4-[5-chloro-4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]pyrimidin-2-yl]-2-ethynyl-6-methylpiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(2S,6R)-4-[5-chloro-4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]pyrimidin-2-yl]-2-ethynyl-6-methylpiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176947843 |
| Molecular Formula | C33H32ClN9O3 |
| Molecular Weight | 638.13 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 3-[6-[(2S,6R)-4-[5-chloro-4-[(1-methyl-2-oxo-3H-indol-5-yl)amino]pyrimidin-2-yl]-2-ethynyl-6-methylpiperazin-1-yl]-1-methylindazol-3-yl]piperidine-2,6-dione |
| SMILES | C#C[C@H]1CN(c2ncc(Cl)c(Nc3ccc4c(c3)CC(=O)N4C)n2)C[C@@H](C)N1c1ccc2c(C3CCC(=O)NC3=O)nn(C)c2c1 |
| InChI | InChI=1S/C33H32ClN9O3/c1-5-21-17-42(33-35-15-25(34)31(38-33)36-20-6-10-26-19(12-20)13-29(45)40(26)3)16-18(2)43(21)22-7-8-23-27(14-22)41(4)39-30(23)24-9-11-28(44)37-32(24)46/h1,6-8,10,12,14-15,18,21,24H,9,11,13,16-17H2,2-4H3,(H,35,36,38)(H,37,44,46)/t18-,21+,24?/m1/s1 |
| InChIKey | OTWKJTRFSPOBMI-BGNYOVEWSA-N |
| XLogP | 3.52 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|