About ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone
ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone (PubChem CID 176948039) has the molecular formula C24H38O
and a molecular weight of 342.57 g/mol. Its IUPAC name is ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone.
Molecular Properties
| Compound Name | ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone |
| PubChem CID | 176948039 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone |
| SMILES | CC.CC.CC.CCc1ccccc1C1=C(C(C)=O)C=C(C)C2CC12 |
| InChI | InChI=1S/C18H20O.3C2H6/c1-4-13-7-5-6-8-14(13)18-16(12(3)19)9-11(2)15-10-17(15)18;3*1-2/h5-9,15,17H,4,10H2,1-3H3;3*1-2H3 |
| InChIKey | CFEFAFPQMYSUFA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone?
The IUPAC name of ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone (CID 176948039) is ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone.
What is the SMILES notation for ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone?
The canonical SMILES for ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone is CC.CC.CC.CCc1ccccc1C1=C(C(C)=O)C=C(C)C2CC12.
What is the InChIKey of ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone?
The InChIKey is CFEFAFPQMYSUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O.3C2H6/c1-4-13-7-5-6-8-14(13)18-16(12(3)19)9-11(2)15-10-17(15)18;3*1-2/h5-9,15,17H,4,10H2,1-3H3;3*1-2H3.
What are the key properties of ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone?
ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone has a molecular weight of 342.57 g/mol, XLogP of 7.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[2-(2-ethylphenyl)-5-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl]ethanone is sourced from PubChem (CID 176948039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).