C11H14N2OS — CID 176948249
N-[(2E,4E)-2-methyl-5-(4-methyl-1,3-thiazol-5-yl)penta-2,4-dienyl]formamide (PubChem CID 176948249) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-[(2E,4E)-2-methyl-5-(4-methyl-1,3-thiazol-5-yl)penta-2,4-dienyl]formamide.
| Compound Name | N-[(2E,4E)-2-methyl-5-(4-methyl-1,3-thiazol-5-yl)penta-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 176948249 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-[(2E,4E)-2-methyl-5-(4-methyl-1,3-thiazol-5-yl)penta-2,4-dienyl]formamide |
| SMILES | C/C(=C\C=C\c1scnc1C)CNC=O |
| InChI | InChI=1S/C11H14N2OS/c1-9(6-12-7-14)4-3-5-11-10(2)13-8-15-11/h3-5,7-8H,6H2,1-2H3,(H,12,14)/b5-3+,9-4+ |
| InChIKey | AUWCOISGEXNOHL-BMVOEDMYSA-N |
| XLogP | 2.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|