About [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium
[2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium (PubChem CID 176949027) has the molecular formula C8H15N2O2V-
and a molecular weight of 222.16 g/mol. Its IUPAC name is [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium.
Molecular Properties
| Compound Name | [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium |
| PubChem CID | 176949027 |
| Molecular Formula | C8H15N2O2V- |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium |
| SMILES | CN1CCC(O)(CC([NH-])=O)CC1.[V] |
| InChI | InChI=1S/C8H16N2O2.V/c1-10-4-2-8(12,3-5-10)6-7(9)11;/h12H,2-6H2,1H3,(H2,9,11);/p-1 |
| InChIKey | AHVWYXJDMSEENC-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium?
The IUPAC name of [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium (CID 176949027) is [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium.
What is the SMILES notation for [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium?
The canonical SMILES for [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium is CN1CCC(O)(CC([NH-])=O)CC1.[V].
What is the InChIKey of [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium?
The InChIKey is AHVWYXJDMSEENC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N2O2.V/c1-10-4-2-8(12,3-5-10)6-7(9)11;/h12H,2-6H2,1H3,(H2,9,11);/p-1.
What are the key properties of [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium?
[2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium has a molecular weight of 222.16 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-hydroxy-1-methylpiperidin-4-yl)acetyl]azanide;vanadium is sourced from PubChem (CID 176949027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).