About 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate
2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate (PubChem CID 176950454) has the molecular formula C30H61NO3
and a molecular weight of 483.82 g/mol. Its IUPAC name is 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate.
Molecular Properties
| Compound Name | 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate |
| PubChem CID | 176950454 |
| Molecular Formula | C30H61NO3 |
| Molecular Weight | 483.82 g/mol |
| Exact Mass | 483.47 |
| IUPAC Name | 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate |
| SMILES | CCCCCCC(CCCCC)COCCNCCOC(=O)C(CCCCC)CCCCCC |
| InChI | InChI=1S/C30H61NO3/c1-5-9-13-17-20-28(19-15-11-7-3)27-33-25-23-31-24-26-34-30(32)29(21-16-12-8-4)22-18-14-10-6-2/h28-29,31H,5-27H2,1-4H3 |
| InChIKey | DRZGNOMGODHPCQ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.82 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate?
The IUPAC name of 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate (CID 176950454) is 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate.
What is the SMILES notation for 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate?
The canonical SMILES for 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate is CCCCCCC(CCCCC)COCCNCCOC(=O)C(CCCCC)CCCCCC.
What is the InChIKey of 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate?
The InChIKey is DRZGNOMGODHPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H61NO3/c1-5-9-13-17-20-28(19-15-11-7-3)27-33-25-23-31-24-26-34-30(32)29(21-16-12-8-4)22-18-14-10-6-2/h28-29,31H,5-27H2,1-4H3.
What are the key properties of 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate?
2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate has a molecular weight of 483.82 g/mol, XLogP of 8.47, 27 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-pentyloctoxy)ethylamino]ethyl 2-pentyloctanoate is sourced from PubChem (CID 176950454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).