About CID 176950572
CID 176950572 (PubChem CID 176950572) has the molecular formula C23H20B9FN2O
and a molecular weight of 456.73 g/mol.
Molecular Properties
| Compound Name | CID 176950572 |
| PubChem CID | 176950572 |
| Molecular Formula | C23H20B9FN2O |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])C(CC(=O)Nc1c(C)cc(N2CCc3cc(F)ccc3C2)cc1C)(C([B])([B])[B])C([B])([B])[B] |
| InChI | InChI=1S/C23H20B9FN2O/c1-12-7-17(35-6-5-14-9-16(33)4-3-15(14)11-35)8-13(2)19(12)34-18(36)10-20(21(24,25)26,22(27,28)29)23(30,31)32/h3-4,7-9H,5-6,10-11H2,1-2H3,(H,34,36) |
| InChIKey | ULDATLOTFZFWLX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176950572 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176950572?
The IUPAC name of CID 176950572 (CID 176950572) is not available.
What is the SMILES notation for CID 176950572?
The canonical SMILES for CID 176950572 is [B]C([B])([B])C(CC(=O)Nc1c(C)cc(N2CCc3cc(F)ccc3C2)cc1C)(C([B])([B])[B])C([B])([B])[B].
What is the InChIKey of CID 176950572?
The InChIKey is ULDATLOTFZFWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20B9FN2O/c1-12-7-17(35-6-5-14-9-16(33)4-3-15(14)11-35)8-13(2)19(12)34-18(36)10-20(21(24,25)26,22(27,28)29)23(30,31)32/h3-4,7-9H,5-6,10-11H2,1-2H3,(H,34,36).
What are the key properties of CID 176950572?
CID 176950572 has a molecular weight of 456.73 g/mol, XLogP of 1.06, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176950572 is sourced from PubChem (CID 176950572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).