C25H36F4N2O3 — CID 176950627
tert-butyl (E)-6-[5-[(4,4-difluoropiperidin-1-yl)methyl]-6-oxo-1H-pyridin-3-yl]-7,7-difluorodec-2-enoate (PubChem CID 176950627) has the molecular formula C25H36F4N2O3 and a molecular weight of 488.57 g/mol. Its IUPAC name is tert-butyl (E)-6-[5-[(4,4-difluoropiperidin-1-yl)methyl]-6-oxo-1H-pyridin-3-yl]-7,7-difluorodec-2-enoate.
| Compound Name | tert-butyl (E)-6-[5-[(4,4-difluoropiperidin-1-yl)methyl]-6-oxo-1H-pyridin-3-yl]-7,7-difluorodec-2-enoate |
|---|---|
| PubChem CID | 176950627 |
| Molecular Formula | C25H36F4N2O3 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | tert-butyl (E)-6-[5-[(4,4-difluoropiperidin-1-yl)methyl]-6-oxo-1H-pyridin-3-yl]-7,7-difluorodec-2-enoate |
| SMILES | CCCC(F)(F)C(CC/C=C/C(=O)OC(C)(C)C)c1c[nH]c(=O)c(CN2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C25H36F4N2O3/c1-5-10-25(28,29)20(8-6-7-9-21(32)34-23(2,3)4)18-15-19(22(33)30-16-18)17-31-13-11-24(26,27)12-14-31/h7,9,15-16,20H,5-6,8,10-14,17H2,1-4H3,(H,30,33)/b9-7+ |
| InChIKey | OWNQWHSWVYCVFS-VQHVLOKHSA-N |
| XLogP | 5.80 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|