About CID 176951009
CID 176951009 (PubChem CID 176951009) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol.
Molecular Properties
| Compound Name | CID 176951009 |
| PubChem CID | 176951009 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | — |
| SMILES | CC.CC(O)(O)C12CC3(CC3)C(O)(O)N1CCC21CC1 |
| InChI | InChI=1S/C13H21NO4.C2H6/c1-9(15,16)12-8-11(4-5-11)13(17,18)14(12)7-6-10(12)2-3-10;1-2/h15-18H,2-8H2,1H3;1-2H3 |
| InChIKey | GXHGHNWLHUZDDB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 176951009 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176951009?
The IUPAC name of CID 176951009 (CID 176951009) is not available.
What is the SMILES notation for CID 176951009?
The canonical SMILES for CID 176951009 is CC.CC(O)(O)C12CC3(CC3)C(O)(O)N1CCC21CC1.
What is the InChIKey of CID 176951009?
The InChIKey is GXHGHNWLHUZDDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO4.C2H6/c1-9(15,16)12-8-11(4-5-11)13(17,18)14(12)7-6-10(12)2-3-10;1-2/h15-18H,2-8H2,1H3;1-2H3.
What are the key properties of CID 176951009?
CID 176951009 has a molecular weight of 285.38 g/mol, XLogP of 0.76, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176951009 is sourced from PubChem (CID 176951009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).