C13H11Cl2FN4O3 — CID 176951112
6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane-5,5-diol (PubChem CID 176951112) has the molecular formula C13H11Cl2FN4O3 and a molecular weight of 361.16 g/mol. Its IUPAC name is 6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane-5,5-diol.
| Compound Name | 6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane-5,5-diol |
|---|---|
| PubChem CID | 176951112 |
| Molecular Formula | C13H11Cl2FN4O3 |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 6-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-oxa-6-azabicyclo[5.1.0]octane-5,5-diol |
| SMILES | OC1(O)CCOC2CC2N1c1nc(Cl)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C13H11Cl2FN4O3/c14-10-8(16)9-5(4-17-10)11(19-12(15)18-9)20-6-3-7(6)23-2-1-13(20,21)22/h4,6-7,21-22H,1-3H2 |
| InChIKey | MAOAWLBGMPXFJC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|