C13H23F2NO2 — CID 176951134
1-[1-[(2,2-difluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol (PubChem CID 176951134) has the molecular formula C13H23F2NO2 and a molecular weight of 263.33 g/mol. Its IUPAC name is 1-[1-[(2,2-difluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol.
| Compound Name | 1-[1-[(2,2-difluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 176951134 |
| Molecular Formula | C13H23F2NO2 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[1-[(2,2-difluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol |
| SMILES | CC(O)(O)C1(C)N(CC2CC2(F)F)CCC1(C)C |
| InChI | InChI=1S/C13H23F2NO2/c1-10(2)5-6-16(8-9-7-13(9,14)15)11(10,3)12(4,17)18/h9,17-18H,5-8H2,1-4H3 |
| InChIKey | IAIWSQZRGLHXRX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|