C15H28FNO2 — CID 176951333
1-[(2R)-1-[(2-fluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]-2-methylpropane-1,1-diol (PubChem CID 176951333) has the molecular formula C15H28FNO2 and a molecular weight of 273.39 g/mol. Its IUPAC name is 1-[(2R)-1-[(2-fluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]-2-methylpropane-1,1-diol.
| Compound Name | 1-[(2R)-1-[(2-fluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]-2-methylpropane-1,1-diol |
|---|---|
| PubChem CID | 176951333 |
| Molecular Formula | C15H28FNO2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-[(2R)-1-[(2-fluorocyclopropyl)methyl]-2,3,3-trimethylpyrrolidin-2-yl]-2-methylpropane-1,1-diol |
| SMILES | CC(C)C(O)(O)[C@]1(C)N(CC2CC2F)CCC1(C)C |
| InChI | InChI=1S/C15H28FNO2/c1-10(2)15(18,19)14(5)13(3,4)6-7-17(14)9-11-8-12(11)16/h10-12,18-19H,6-9H2,1-5H3/t11?,12?,14-/m1/s1 |
| InChIKey | LFBWQHRABZRMER-ORHYLEIMSA-N |
| XLogP | 2.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|