About ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol
ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol (PubChem CID 176951455) has the molecular formula C17H23F3O4
and a molecular weight of 348.36 g/mol. Its IUPAC name is ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol.
Molecular Properties
| Compound Name | ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol |
| PubChem CID | 176951455 |
| Molecular Formula | C17H23F3O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol |
| SMILES | CC.CC.CCc1cc(O)cc2cc(F)c(F)c(OC(O)(O)F)c12 |
| InChI | InChI=1S/C13H11F3O4.2C2H6/c1-2-6-3-8(17)4-7-5-9(14)11(15)12(10(6)7)20-13(16,18)19;2*1-2/h3-5,17-19H,2H2,1H3;2*1-2H3 |
| InChIKey | DYEXAAZYZQFGHN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol?
The IUPAC name of ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol (CID 176951455) is ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol.
What is the SMILES notation for ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol?
The canonical SMILES for ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol is CC.CC.CCc1cc(O)cc2cc(F)c(F)c(OC(O)(O)F)c12.
What is the InChIKey of ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol?
The InChIKey is DYEXAAZYZQFGHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3O4.2C2H6/c1-2-6-3-8(17)4-7-5-9(14)11(15)12(10(6)7)20-13(16,18)19;2*1-2/h3-5,17-19H,2H2,1H3;2*1-2H3.
What are the key properties of ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol?
ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol has a molecular weight of 348.36 g/mol, XLogP of 4.38, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(8-ethyl-2,3-difluoro-6-hydroxynaphthalen-1-yl)oxy-fluoromethanediol is sourced from PubChem (CID 176951455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).