C11H23NO2 — CID 176951545
1-[(2R)-1-ethyl-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol (PubChem CID 176951545) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-[(2R)-1-ethyl-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol.
| Compound Name | 1-[(2R)-1-ethyl-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 176951545 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1-[(2R)-1-ethyl-2,3,3-trimethylpyrrolidin-2-yl]ethane-1,1-diol |
| SMILES | CCN1CCC(C)(C)[C@]1(C)C(C)(O)O |
| InChI | InChI=1S/C11H23NO2/c1-6-12-8-7-9(2,3)10(12,4)11(5,13)14/h13-14H,6-8H2,1-5H3/t10-/m1/s1 |
| InChIKey | VXWOHBPGPJPZAP-SNVBAGLBSA-N |
| XLogP | 1.20 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|