C43H78O6 — CID 176951930
bis[(Z)-octadec-9-enyl] 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 176951930) has the molecular formula C43H78O6 and a molecular weight of 691.09 g/mol. Its IUPAC name is bis[(Z)-octadec-9-enyl] 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | bis[(Z)-octadec-9-enyl] 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 176951930 |
| Molecular Formula | C43H78O6 |
| Molecular Weight | 691.09 g/mol |
| Exact Mass | 690.58 |
| IUPAC Name | bis[(Z)-octadec-9-enyl] 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)C1OC(C)(C)OC1C(=O)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H78O6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-46-41(44)39-40(49-43(3,4)48-39)42(45)47-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,39-40H,5-18,23-38H2,1-4H3/b21-19-,22-20- |
| InChIKey | MIKPFYBKGGFXCP-WRBBJXAJSA-N |
| XLogP | 12.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.09 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|