About [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate
[(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate (PubChem CID 176952765) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| PubChem CID | 176952765 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(O)CN[C@@H]1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H17NO4/c1-8(15)18-13-11(14-7-12(13)17)6-9-2-4-10(16)5-3-9/h2-5,11-14,16-17H,6-7H2,1H3/t11-,12?,13+/m1/s1 |
| InChIKey | YEXDUWHXOFKCLS-YPHAAILGSA-N |
| XLogP | 0.20 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate?
The IUPAC name of [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate (CID 176952765) is [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate.
What is the SMILES notation for [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate?
The canonical SMILES for [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate is CC(=O)O[C@@H]1C(O)CN[C@@H]1Cc1ccc(O)cc1.
What is the InChIKey of [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate?
The InChIKey is YEXDUWHXOFKCLS-YPHAAILGSA-N. The full InChI is InChI=1S/C13H17NO4/c1-8(15)18-13-11(14-7-12(13)17)6-9-2-4-10(16)5-3-9/h2-5,11-14,16-17H,6-7H2,1H3/t11-,12?,13+/m1/s1.
What are the key properties of [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate?
[(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate has a molecular weight of 251.28 g/mol, XLogP of 0.20, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-4-hydroxy-2-[(4-hydroxyphenyl)methyl]pyrrolidin-3-yl] acetate is sourced from PubChem (CID 176952765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).