C12H24NO4P — CID 176953458
[4-hydroxy-1-(2-methylpropanoyl)pyrrolidin-2-yl]methoxy-propan-2-ylphosphinous acid (PubChem CID 176953458) has the molecular formula C12H24NO4P and a molecular weight of 277.30 g/mol. Its IUPAC name is [4-hydroxy-1-(2-methylpropanoyl)pyrrolidin-2-yl]methoxy-propan-2-ylphosphinous acid.
| Compound Name | [4-hydroxy-1-(2-methylpropanoyl)pyrrolidin-2-yl]methoxy-propan-2-ylphosphinous acid |
|---|---|
| PubChem CID | 176953458 |
| Molecular Formula | C12H24NO4P |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [4-hydroxy-1-(2-methylpropanoyl)pyrrolidin-2-yl]methoxy-propan-2-ylphosphinous acid |
| SMILES | CC(C)C(=O)N1CC(O)CC1COP(O)C(C)C |
| InChI | InChI=1S/C12H24NO4P/c1-8(2)12(15)13-6-11(14)5-10(13)7-17-18(16)9(3)4/h8-11,14,16H,5-7H2,1-4H3 |
| InChIKey | OFOKUEQTUYQCFH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|