C34H59F2N5O — CID 176953961
4,4-difluorocyclohexane-1-carbaldehyde;N-ethanimidoyl-N-[1-[4-methyl-1-[3-(methylamino)-3-phenylpropyl]azetidin-2-yl]propan-2-yl]ethanimidamide;2-methylpentane (PubChem CID 176953961) has the molecular formula C34H59F2N5O and a molecular weight of 591.88 g/mol. Its IUPAC name is 4,4-difluorocyclohexane-1-carbaldehyde;N-ethanimidoyl-N-[1-[4-methyl-1-[3-(methylamino)-3-phenylpropyl]azetidin-2-yl]propan-2-yl]ethanimidamide;2-methylpentane.
| Compound Name | 4,4-difluorocyclohexane-1-carbaldehyde;N-ethanimidoyl-N-[1-[4-methyl-1-[3-(methylamino)-3-phenylpropyl]azetidin-2-yl]propan-2-yl]ethanimidamide;2-methylpentane |
|---|---|
| PubChem CID | 176953961 |
| Molecular Formula | C34H59F2N5O |
| Molecular Weight | 591.88 g/mol |
| Exact Mass | 591.47 |
| IUPAC Name | 4,4-difluorocyclohexane-1-carbaldehyde;N-ethanimidoyl-N-[1-[4-methyl-1-[3-(methylamino)-3-phenylpropyl]azetidin-2-yl]propan-2-yl]ethanimidamide;2-methylpentane |
| SMILES | CCCC(C)C.O=CC1CCC(F)(F)CC1.[H]/N=C(\C)N(/C(C)=N/[H])C(C)CC1CC(C)N1CCC(NC)c1ccccc1 |
| InChI | InChI=1S/C21H35N5.C7H10F2O.C6H14/c1-15-13-20(14-16(2)26(17(3)22)18(4)23)25(15)12-11-21(24-5)19-9-7-6-8-10-19;8-7(9)3-1-6(5-10)2-4-7;1-4-5-6(2)3/h6-10,15-16,20-24H,11-14H2,1-5H3;5-6H,1-4H2;6H,4-5H2,1-3H3/b22-17+,23-18+;; |
| InChIKey | XEDRVPFPIORJCH-XJAABRCYSA-N |
| XLogP | 8.33 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.88 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|