C33H49N5O — CID 176954285
N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-phenylpropyl]undec-10-ynamide (PubChem CID 176954285) has the molecular formula C33H49N5O and a molecular weight of 531.79 g/mol. Its IUPAC name is N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-phenylpropyl]undec-10-ynamide.
| Compound Name | N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-phenylpropyl]undec-10-ynamide |
|---|---|
| PubChem CID | 176954285 |
| Molecular Formula | C33H49N5O |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-phenylpropyl]undec-10-ynamide |
| SMILES | C#CCCCCCCCCC(=O)N[C@@H](CCN1C2CCC1CC(n1c(C)nnc1C(C)C)C2)c1ccccc1 |
| InChI | InChI=1S/C33H49N5O/c1-5-6-7-8-9-10-11-15-18-32(39)34-31(27-16-13-12-14-17-27)21-22-37-28-19-20-29(37)24-30(23-28)38-26(4)35-36-33(38)25(2)3/h1,12-14,16-17,25,28-31H,6-11,15,18-24H2,2-4H3,(H,34,39)/t28?,29?,30?,31-/m0/s1 |
| InChIKey | VNOIMDFRNGOIKF-AAKDHKQZSA-N |
| XLogP | 6.88 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|