About CID 176954982
CID 176954982 (PubChem CID 176954982) has the molecular formula C26H35BN4O2
and a molecular weight of 446.40 g/mol.
Molecular Properties
| Compound Name | CID 176954982 |
| PubChem CID | 176954982 |
| Molecular Formula | C26H35BN4O2 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | — |
| SMILES | [B]C(C)(O)N(c1cc(CC)nc2c1CCC(c1c(CCC)ccc(N)c1C#N)C2)C(C)(C)O |
| InChI | InChI=1S/C26H35BN4O2/c1-6-8-16-10-12-21(29)20(15-28)24(16)17-9-11-19-22(13-17)30-18(7-2)14-23(19)31(25(3,4)32)26(5,27)33/h10,12,14,17,32-33H,6-9,11,13,29H2,1-5H3 |
| InChIKey | XZMJKPANHVFBPT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 176954982 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176954982?
The IUPAC name of CID 176954982 (CID 176954982) is not available.
What is the SMILES notation for CID 176954982?
The canonical SMILES for CID 176954982 is [B]C(C)(O)N(c1cc(CC)nc2c1CCC(c1c(CCC)ccc(N)c1C#N)C2)C(C)(C)O.
What is the InChIKey of CID 176954982?
The InChIKey is XZMJKPANHVFBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35BN4O2/c1-6-8-16-10-12-21(29)20(15-28)24(16)17-9-11-19-22(13-17)30-18(7-2)14-23(19)31(25(3,4)32)26(5,27)33/h10,12,14,17,32-33H,6-9,11,13,29H2,1-5H3.
What are the key properties of CID 176954982?
CID 176954982 has a molecular weight of 446.40 g/mol, XLogP of 3.69, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176954982 is sourced from PubChem (CID 176954982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).