C30H40ClN5O6S — CID 176955480
6-chloro-1-(5-ethyloxolan-2-yl)-N-[1-phenyl-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfinyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 176955480) has the molecular formula C30H40ClN5O6S and a molecular weight of 634.20 g/mol. Its IUPAC name is 6-chloro-1-(5-ethyloxolan-2-yl)-N-[1-phenyl-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfinyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-1-(5-ethyloxolan-2-yl)-N-[1-phenyl-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfinyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176955480 |
| Molecular Formula | C30H40ClN5O6S |
| Molecular Weight | 634.20 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | 6-chloro-1-(5-ethyloxolan-2-yl)-N-[1-phenyl-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfinyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C#CCOCCOCCOCCOCCS(=O)CC(Nc1nc(Cl)nc2c1cnn2C1CCC(CC)O1)c1ccccc1 |
| InChI | InChI=1S/C30H40ClN5O6S/c1-3-12-38-13-14-39-15-16-40-17-18-41-19-20-43(37)22-26(23-8-6-5-7-9-23)33-28-25-21-32-36(29(25)35-30(31)34-28)27-11-10-24(4-2)42-27/h1,5-9,21,24,26-27H,4,10-20,22H2,2H3,(H,33,34,35) |
| InChIKey | HRWYECMLNPTLAK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|