C24H30ClN5O5 — CID 176955642
N-[(2-chlorophenyl)methyl]-6-methoxy-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 176955642) has the molecular formula C24H30ClN5O5 and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-methoxy-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-methoxy-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176955642 |
| Molecular Formula | C24H30ClN5O5 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-methoxy-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | C#CCOCCOCCOCCOCCN(Cc1ccccc1Cl)c1nc(OC)nc2[nH]ncc12 |
| InChI | InChI=1S/C24H30ClN5O5/c1-3-9-32-11-13-34-15-16-35-14-12-33-10-8-30(18-19-6-4-5-7-21(19)25)23-20-17-26-29-22(20)27-24(28-23)31-2/h1,4-7,17H,8-16,18H2,2H3,(H,26,27,28,29) |
| InChIKey | MLWQCVUQGZPKIU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|