About (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine
(2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine (PubChem CID 176956813) has the molecular formula C13H19FN2O
and a molecular weight of 238.31 g/mol. Its IUPAC name is (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine |
| PubChem CID | 176956813 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine |
| SMILES | CCc1cc(F)cc(N2C[C@@H](C)O[C@@H](C)C2)n1 |
| InChI | InChI=1S/C13H19FN2O/c1-4-12-5-11(14)6-13(15-12)16-7-9(2)17-10(3)8-16/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+ |
| InChIKey | BXIZYXSAFLRLSI-AOOOYVTPSA-N |
| XLogP | 2.40 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine?
The IUPAC name of (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine (CID 176956813) is (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine.
What is the SMILES notation for (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine?
The canonical SMILES for (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine is CCc1cc(F)cc(N2C[C@@H](C)O[C@@H](C)C2)n1.
What is the InChIKey of (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine?
The InChIKey is BXIZYXSAFLRLSI-AOOOYVTPSA-N. The full InChI is InChI=1S/C13H19FN2O/c1-4-12-5-11(14)6-13(15-12)16-7-9(2)17-10(3)8-16/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+.
What are the key properties of (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine?
(2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine has a molecular weight of 238.31 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-(6-ethyl-4-fluoro-2-pyridinyl)-2,6-dimethylmorpholine is sourced from PubChem (CID 176956813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).