C29H31N5O2 — CID 176957359
2-(4-ethoxyphenyl)-N-[3-[(3S)-3-pyridin-3-ylpyrrolidin-1-yl]propyl]quinazoline-4-carboxamide (PubChem CID 176957359) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[3-[(3S)-3-pyridin-3-ylpyrrolidin-1-yl]propyl]quinazoline-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[3-[(3S)-3-pyridin-3-ylpyrrolidin-1-yl]propyl]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 176957359 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[3-[(3S)-3-pyridin-3-ylpyrrolidin-1-yl]propyl]quinazoline-4-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NCCCN3CC[C@@H](c4cccnc4)C3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H31N5O2/c1-2-36-24-12-10-21(11-13-24)28-32-26-9-4-3-8-25(26)27(33-28)29(35)31-16-6-17-34-18-14-23(20-34)22-7-5-15-30-19-22/h3-5,7-13,15,19,23H,2,6,14,16-18,20H2,1H3,(H,31,35)/t23-/m1/s1 |
| InChIKey | LISMAILKTLDNTH-HSZRJFAPSA-N |
| XLogP | 4.70 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|