About 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide
8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide (PubChem CID 176957751) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide.
Molecular Properties
| Compound Name | 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide |
| PubChem CID | 176957751 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide |
| SMILES | NNc1cccc2cc(C(=O)NNO)cnc12 |
| InChI | InChI=1S/C10H11N5O2/c11-13-8-3-1-2-6-4-7(5-12-9(6)8)10(16)14-15-17/h1-5,13,15,17H,11H2,(H,14,16) |
| InChIKey | SGBIEEZLPVLJAV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide?
The IUPAC name of 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide (CID 176957751) is 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide.
What is the SMILES notation for 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide?
The canonical SMILES for 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide is NNc1cccc2cc(C(=O)NNO)cnc12.
What is the InChIKey of 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide?
The InChIKey is SGBIEEZLPVLJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2/c11-13-8-3-1-2-6-4-7(5-12-9(6)8)10(16)14-15-17/h1-5,13,15,17H,11H2,(H,14,16).
What are the key properties of 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide?
8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide has a molecular weight of 233.23 g/mol, XLogP of 0.14, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydrazinyl-N'-hydroxyquinoline-3-carbohydrazide is sourced from PubChem (CID 176957751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).