About lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide
lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide (PubChem CID 176957925) has the molecular formula C15H12LiNO2-2
and a molecular weight of 245.21 g/mol. Its IUPAC name is lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide.
Molecular Properties
| Compound Name | lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide |
| PubChem CID | 176957925 |
| Molecular Formula | C15H12LiNO2-2 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide |
| SMILES | COC(=O)c1ccc2[c-]cccc2c1.[H]/[C-]=C/C=[N-].[Li+] |
| InChI | InChI=1S/C12H9O2.C3H3N.Li/c1-14-12(13)11-7-6-9-4-2-3-5-10(9)8-11;1-2-3-4;/h2-3,5-8H,1H3;1-3H;/q-1;-2;+1 |
| InChIKey | BTYZLQNBQACJNI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 48.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide?
The IUPAC name of lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide (CID 176957925) is lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide.
What is the SMILES notation for lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide?
The canonical SMILES for lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide is COC(=O)c1ccc2[c-]cccc2c1.[H]/[C-]=C/C=[N-].[Li+].
What is the InChIKey of lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide?
The InChIKey is BTYZLQNBQACJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9O2.C3H3N.Li/c1-14-12(13)11-7-6-9-4-2-3-5-10(9)8-11;1-2-3-4;/h2-3,5-8H,1H3;1-3H;/q-1;-2;+1.
What are the key properties of lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide?
lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide has a molecular weight of 245.21 g/mol, XLogP of 0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;methyl 5H-naphthalen-5-ide-2-carboxylate;prop-2-enylideneazanide is sourced from PubChem (CID 176957925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).