C27H42F3N — CID 176958253
ethane;3-[(2Z,4E)-hepta-2,4-dien-2-yl]-2-methyl-N-[(2E,4E)-2-propyl-5-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-en-1-amine (PubChem CID 176958253) has the molecular formula C27H42F3N and a molecular weight of 437.63 g/mol. Its IUPAC name is ethane;3-[(2Z,4E)-hepta-2,4-dien-2-yl]-2-methyl-N-[(2E,4E)-2-propyl-5-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-en-1-amine.
| Compound Name | ethane;3-[(2Z,4E)-hepta-2,4-dien-2-yl]-2-methyl-N-[(2E,4E)-2-propyl-5-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 176958253 |
| Molecular Formula | C27H42F3N |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | ethane;3-[(2Z,4E)-hepta-2,4-dien-2-yl]-2-methyl-N-[(2E,4E)-2-propyl-5-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-en-1-amine |
| SMILES | C=C/C(=C\C=C(/CCC)CNC1CCCC(/C(C)=C\C=C\CC)=C1C)C(F)(F)F.CC |
| InChI | InChI=1S/C25H36F3N.C2H6/c1-6-9-10-13-19(4)23-14-11-15-24(20(23)5)29-18-21(12-7-2)16-17-22(8-3)25(26,27)28;1-2/h8-10,13,16-17,24,29H,3,6-7,11-12,14-15,18H2,1-2,4-5H3;1-2H3/b10-9+,19-13-,21-16+,22-17+; |
| InChIKey | MOCIYZINBXUFPC-UWSHWVKKSA-N |
| XLogP | 8.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|