C33H55N5O5 — CID 176958865
2-(buta-1,3-dien-2-ylamino)-2-cyclopentyl-1-(2-methylpyrrolidin-1-yl)ethanone;N-cyclopentyl-3-formamido-2-oxo-4-(2-oxopyrrolidin-3-yl)butanamide;propane (PubChem CID 176958865) has the molecular formula C33H55N5O5 and a molecular weight of 601.83 g/mol. Its IUPAC name is 2-(buta-1,3-dien-2-ylamino)-2-cyclopentyl-1-(2-methylpyrrolidin-1-yl)ethanone;N-cyclopentyl-3-formamido-2-oxo-4-(2-oxopyrrolidin-3-yl)butanamide;propane.
| Compound Name | 2-(buta-1,3-dien-2-ylamino)-2-cyclopentyl-1-(2-methylpyrrolidin-1-yl)ethanone;N-cyclopentyl-3-formamido-2-oxo-4-(2-oxopyrrolidin-3-yl)butanamide;propane |
|---|---|
| PubChem CID | 176958865 |
| Molecular Formula | C33H55N5O5 |
| Molecular Weight | 601.83 g/mol |
| Exact Mass | 601.42 |
| IUPAC Name | 2-(buta-1,3-dien-2-ylamino)-2-cyclopentyl-1-(2-methylpyrrolidin-1-yl)ethanone;N-cyclopentyl-3-formamido-2-oxo-4-(2-oxopyrrolidin-3-yl)butanamide;propane |
| SMILES | C=CC(=C)NC(C(=O)N1CCCC1C)C1CCCC1.CCC.O=CNC(CC1CCNC1=O)C(=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H26N2O.C14H21N3O4.C3H8/c1-4-12(2)17-15(14-9-5-6-10-14)16(19)18-11-7-8-13(18)3;18-8-16-11(7-9-5-6-15-13(9)20)12(19)14(21)17-10-3-1-2-4-10;1-3-2/h4,13-15,17H,1-2,5-11H2,3H3;8-11H,1-7H2,(H,15,20)(H,16,18)(H,17,21);3H2,1-2H3 |
| InChIKey | KYPDQPQERHSGPA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|