About CID 176959126
CID 176959126 (PubChem CID 176959126) has the molecular formula C29H33B2ClFN7O3
and a molecular weight of 603.70 g/mol.
Molecular Properties
| Compound Name | CID 176959126 |
| PubChem CID | 176959126 |
| Molecular Formula | C29H33B2ClFN7O3 |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | — |
| SMILES | [B]C1([B])C(/C=N/C)=C(/N)c2ccc(F)cc2[C@@H](C)Oc2cc(cnc2NCOC(=O)C(N)C(C)C)-c2c1c(Cl)nn2CC |
| InChI | InChI=1S/C29H33B2ClFN7O3/c1-6-40-25-16-9-21(27(37-11-16)38-13-42-28(41)23(34)14(2)3)43-15(4)19-10-17(33)7-8-18(19)24(35)20(12-36-5)29(30,31)22(25)26(32)39-40/h7-12,14-15,23H,6,13,34-35H2,1-5H3,(H,37,38)/b24-20+,36-12+/t15-,23?/m1/s1 |
| InChIKey | ZLBNJCKGXCLEJV-YQFKZPSNSA-N |
| XLogP | 3.67 |
| TPSA | 142.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 176959126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176959126?
The IUPAC name of CID 176959126 (CID 176959126) is not available.
What is the SMILES notation for CID 176959126?
The canonical SMILES for CID 176959126 is [B]C1([B])C(/C=N/C)=C(/N)c2ccc(F)cc2[C@@H](C)Oc2cc(cnc2NCOC(=O)C(N)C(C)C)-c2c1c(Cl)nn2CC.
What is the InChIKey of CID 176959126?
The InChIKey is ZLBNJCKGXCLEJV-YQFKZPSNSA-N. The full InChI is InChI=1S/C29H33B2ClFN7O3/c1-6-40-25-16-9-21(27(37-11-16)38-13-42-28(41)23(34)14(2)3)43-15(4)19-10-17(33)7-8-18(19)24(35)20(12-36-5)29(30,31)22(25)26(32)39-40/h7-12,14-15,23H,6,13,34-35H2,1-5H3,(H,37,38)/b24-20+,36-12+/t15-,23?/m1/s1.
What are the key properties of CID 176959126?
CID 176959126 has a molecular weight of 603.70 g/mol, XLogP of 3.67, 7 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176959126 is sourced from PubChem (CID 176959126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).