C22H20ClFN6O — CID 176959145
5-chloro-3-ethyl-16-fluoro-10-methyl-20-oxa-3,4,10,11,23-pentazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine (PubChem CID 176959145) has the molecular formula C22H20ClFN6O and a molecular weight of 438.89 g/mol. Its IUPAC name is 5-chloro-3-ethyl-16-fluoro-10-methyl-20-oxa-3,4,10,11,23-pentazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine.
| Compound Name | 5-chloro-3-ethyl-16-fluoro-10-methyl-20-oxa-3,4,10,11,23-pentazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine |
|---|---|
| PubChem CID | 176959145 |
| Molecular Formula | C22H20ClFN6O |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 5-chloro-3-ethyl-16-fluoro-10-methyl-20-oxa-3,4,10,11,23-pentazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8,11,13(18),14,16,21,23-decaen-22-amine |
| SMILES | CCn1nc(Cl)c2c1-c1cnc(N)c(c1)OCc1cc(F)ccc1-c1nn(C)cc1C2 |
| InChI | InChI=1S/C22H20ClFN6O/c1-3-30-20-12-8-18(22(25)26-9-12)31-11-14-6-15(24)4-5-16(14)19-13(10-29(2)27-19)7-17(20)21(23)28-30/h4-6,8-10H,3,7,11H2,1-2H3,(H2,25,26) |
| InChIKey | RMKXBINXIAUWTI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|