About acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen
acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen (PubChem CID 176959319) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen.
Molecular Properties
| Compound Name | acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen |
| PubChem CID | 176959319 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen |
| SMILES | CC#N.CNCc1ccc(C)c(OC)c1.[H][H] |
| InChI | InChI=1S/C10H15NO.C2H3N.H2/c1-8-4-5-9(7-11-2)6-10(8)12-3;1-2-3;/h4-6,11H,7H2,1-3H3;1H3;1H |
| InChIKey | VIRJLRCHQYALQF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen?
The IUPAC name of acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen (CID 176959319) is acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen.
What is the SMILES notation for acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen?
The canonical SMILES for acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen is CC#N.CNCc1ccc(C)c(OC)c1.[H][H].
What is the InChIKey of acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen?
The InChIKey is VIRJLRCHQYALQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.C2H3N.H2/c1-8-4-5-9(7-11-2)6-10(8)12-3;1-2-3;/h4-6,11H,7H2,1-3H3;1H3;1H.
What are the key properties of acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen?
acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen has a molecular weight of 208.30 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1-(3-methoxy-4-methylphenyl)-N-methylmethanamine;molecular hydrogen is sourced from PubChem (CID 176959319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).