About (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine
(E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine (PubChem CID 176960204) has the molecular formula C8H11BrN2S2
and a molecular weight of 279.23 g/mol. Its IUPAC name is (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine.
Molecular Properties
| Compound Name | (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine |
| PubChem CID | 176960204 |
| Molecular Formula | C8H11BrN2S2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine |
| SMILES | CC(C)(C)S/N=C/c1cnc(Br)s1 |
| InChI | InChI=1S/C8H11BrN2S2/c1-8(2,3)13-11-5-6-4-10-7(9)12-6/h4-5H,1-3H3/b11-5+ |
| InChIKey | KNRMBXFODKIDFI-VZUCSPMQSA-N |
| XLogP | 3.77 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine?
The IUPAC name of (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine (CID 176960204) is (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine.
What is the SMILES notation for (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine?
The canonical SMILES for (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine is CC(C)(C)S/N=C/c1cnc(Br)s1.
What is the InChIKey of (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine?
The InChIKey is KNRMBXFODKIDFI-VZUCSPMQSA-N. The full InChI is InChI=1S/C8H11BrN2S2/c1-8(2,3)13-11-5-6-4-10-7(9)12-6/h4-5H,1-3H3/b11-5+.
What are the key properties of (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine?
(E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine has a molecular weight of 279.23 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2-bromo-1,3-thiazol-5-yl)-N-tert-butylsulfanylmethanimine is sourced from PubChem (CID 176960204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).