About ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine
ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine (PubChem CID 176960936) has the molecular formula C12H30N2O2
and a molecular weight of 234.38 g/mol. Its IUPAC name is ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine.
Molecular Properties
| Compound Name | ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine |
| PubChem CID | 176960936 |
| Molecular Formula | C12H30N2O2 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine |
| SMILES | CC.CC(C)(O)CCNC=O.CNC(C)C |
| InChI | InChI=1S/C6H13NO2.C4H11N.C2H6/c1-6(2,9)3-4-7-5-8;1-4(2)5-3;1-2/h5,9H,3-4H2,1-2H3,(H,7,8);4-5H,1-3H3;1-2H3 |
| InChIKey | YOARURHZYHJUIF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine?
The IUPAC name of ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine (CID 176960936) is ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine.
What is the SMILES notation for ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine?
The canonical SMILES for ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine is CC.CC(C)(O)CCNC=O.CNC(C)C.
What is the InChIKey of ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine?
The InChIKey is YOARURHZYHJUIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.C4H11N.C2H6/c1-6(2,9)3-4-7-5-8;1-4(2)5-3;1-2/h5,9H,3-4H2,1-2H3,(H,7,8);4-5H,1-3H3;1-2H3.
What are the key properties of ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine?
ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine has a molecular weight of 234.38 g/mol, XLogP of 1.53, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(3-hydroxy-3-methylbutyl)formamide;N-methylpropan-2-amine is sourced from PubChem (CID 176960936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).