About methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate
methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate (PubChem CID 176961281) has the molecular formula C14H18FNO2
and a molecular weight of 251.30 g/mol. Its IUPAC name is methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 176961281 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate |
| SMILES | C/C=C1/C(C(=O)OC)=CC=C(F)/C1=N\[C@@H](C)CC |
| InChI | InChI=1S/C14H18FNO2/c1-5-9(3)16-13-10(6-2)11(14(17)18-4)7-8-12(13)15/h6-9H,5H2,1-4H3/b10-6-,16-13-/t9-/m0/s1 |
| InChIKey | ZICLQAXJHYMVAN-PVMUQRBASA-N |
| XLogP | 3.14 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate (CID 176961281) is methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate is C/C=C1/C(C(=O)OC)=CC=C(F)/C1=N\[C@@H](C)CC.
What is the InChIKey of methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate?
The InChIKey is ZICLQAXJHYMVAN-PVMUQRBASA-N. The full InChI is InChI=1S/C14H18FNO2/c1-5-9(3)16-13-10(6-2)11(14(17)18-4)7-8-12(13)15/h6-9H,5H2,1-4H3/b10-6-,16-13-/t9-/m0/s1.
What are the key properties of methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate?
methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate has a molecular weight of 251.30 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6Z)-5-[(2S)-butan-2-yl]imino-6-ethylidene-4-fluorocyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 176961281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).