C12H20N2 — CID 176962199
2,7-dimethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane (PubChem CID 176962199) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2,7-dimethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane.
| Compound Name | 2,7-dimethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane |
|---|---|
| PubChem CID | 176962199 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2,7-dimethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;ethane |
| SMILES | CC.Cc1ccc2c(n1)NC(C)CC2 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-7-3-5-9-6-4-8(2)12-10(9)11-7;1-2/h3,5,8H,4,6H2,1-2H3,(H,11,12);1-2H3 |
| InChIKey | WKXKOCSZPFVRJI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |