C29H43F3N6O3 — CID 176962926
4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[(E)-1-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]but-1-enyl]amino]butanoic acid (PubChem CID 176962926) has the molecular formula C29H43F3N6O3 and a molecular weight of 580.70 g/mol. Its IUPAC name is 4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[(E)-1-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]but-1-enyl]amino]butanoic acid.
| Compound Name | 4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[(E)-1-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]but-1-enyl]amino]butanoic acid |
|---|---|
| PubChem CID | 176962926 |
| Molecular Formula | C29H43F3N6O3 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 4-[2-ethoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[(E)-1-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]but-1-enyl]amino]butanoic acid |
| SMILES | CC/C=C(/NC(CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC)C(=O)O)c1cn(C)nc1C(F)(F)F |
| InChI | InChI=1S/C29H43F3N6O3/c1-4-9-24(23-20-37(3)36-26(23)29(30,31)32)35-25(28(39)40)14-17-38(18-19-41-5-2)16-7-6-11-22-13-12-21-10-8-15-33-27(21)34-22/h9,12-13,20,25,35H,4-8,10-11,14-19H2,1-3H3,(H,33,34)(H,39,40)/b24-9+ |
| InChIKey | AFSCORGOZAGJIB-PGGKNCGUSA-N |
| XLogP | 4.74 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|