C26H44N4O4 — CID 176962972
2-methoxy-2-methylpropane;methyl 4-[cyclopropyl-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoate (PubChem CID 176962972) has the molecular formula C26H44N4O4 and a molecular weight of 476.66 g/mol. Its IUPAC name is 2-methoxy-2-methylpropane;methyl 4-[cyclopropyl-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoate.
| Compound Name | 2-methoxy-2-methylpropane;methyl 4-[cyclopropyl-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoate |
|---|---|
| PubChem CID | 176962972 |
| Molecular Formula | C26H44N4O4 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | 2-methoxy-2-methylpropane;methyl 4-[cyclopropyl-[4-(1,2,3,4-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-formamidobutanoate |
| SMILES | COC(=O)C(CCN(CCCCC1CCc2cccnc2N1)C1CC1)NC=O.COC(C)(C)C |
| InChI | InChI=1S/C21H32N4O3.C5H12O/c1-28-21(27)19(23-15-26)11-14-25(18-9-10-18)13-3-2-6-17-8-7-16-5-4-12-22-20(16)24-17;1-5(2,3)6-4/h4-5,12,15,17-19H,2-3,6-11,13-14H2,1H3,(H,22,24)(H,23,26);1-4H3 |
| InChIKey | FSQIDPDVDQZSRT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|